C42H24N6 — CID 140769550
4-[3-[3-[3-(3-cyano-4-pyridinyl)phenyl]-5-[3-(3-isocyano-4-pyridinyl)phenyl]phenyl]phenyl]pyridine-3-carbonitrile (PubChem CID 140769550) has the molecular formula C42H24N6 and a molecular weight of 612.70 g/mol. Its IUPAC name is 4-[3-[3-[3-(3-cyano-4-pyridinyl)phenyl]-5-[3-(3-isocyano-4-pyridinyl)phenyl]phenyl]phenyl]pyridine-3-carbonitrile.
| Compound Name | 4-[3-[3-[3-(3-cyano-4-pyridinyl)phenyl]-5-[3-(3-isocyano-4-pyridinyl)phenyl]phenyl]phenyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 140769550 |
| Molecular Formula | C42H24N6 |
| Molecular Weight | 612.70 g/mol |
| Exact Mass | 612.21 |
| IUPAC Name | 4-[3-[3-[3-(3-cyano-4-pyridinyl)phenyl]-5-[3-(3-isocyano-4-pyridinyl)phenyl]phenyl]phenyl]pyridine-3-carbonitrile |
| SMILES | [C-]#[N+]c1cnccc1-c1cccc(-c2cc(-c3cccc(-c4ccncc4C#N)c3)cc(-c3cccc(-c4ccncc4C#N)c3)c2)c1 |
| InChI | InChI=1S/C42H24N6/c1-45-42-27-48-16-13-41(42)33-10-4-7-30(19-33)36-21-34(28-5-2-8-31(17-28)39-11-14-46-25-37(39)23-43)20-35(22-36)29-6-3-9-32(18-29)40-12-15-47-26-38(40)24-44/h2-22,25-27H |
| InChIKey | RYLXXCFNGXNPAM-UHFFFAOYSA-N |
| XLogP | 10.17 |
| TPSA | 90.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.70 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|