C17H11N3 — CID 46316425
2,5-dipyridin-3-ylbenzonitrile (PubChem CID 46316425) has the molecular formula C17H11N3 and a molecular weight of 257.30 g/mol. Its IUPAC name is 2,5-dipyridin-3-ylbenzonitrile.
| Compound Name | 2,5-dipyridin-3-ylbenzonitrile |
|---|---|
| PubChem CID | 46316425 |
| Molecular Formula | C17H11N3 |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 2,5-dipyridin-3-ylbenzonitrile |
| SMILES | N#Cc1cc(-c2cccnc2)ccc1-c1cccnc1 |
| InChI | InChI=1S/C17H11N3/c18-10-16-9-13(14-3-1-7-19-11-14)5-6-17(16)15-4-2-8-20-12-15/h1-9,11-12H |
| InChIKey | JPQHRELRROMUHV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |