C64H34N8 — CID 140846580
2-[3,6-bis(2-cyanophenyl)carbazol-9-yl]-5-[3,6-bis(2-isocyanophenyl)carbazol-9-yl]-4-pyridin-4-ylbenzonitrile (PubChem CID 140846580) has the molecular formula C64H34N8 and a molecular weight of 915.03 g/mol. Its IUPAC name is 2-[3,6-bis(2-cyanophenyl)carbazol-9-yl]-5-[3,6-bis(2-isocyanophenyl)carbazol-9-yl]-4-pyridin-4-ylbenzonitrile.
| Compound Name | 2-[3,6-bis(2-cyanophenyl)carbazol-9-yl]-5-[3,6-bis(2-isocyanophenyl)carbazol-9-yl]-4-pyridin-4-ylbenzonitrile |
|---|---|
| PubChem CID | 140846580 |
| Molecular Formula | C64H34N8 |
| Molecular Weight | 915.03 g/mol |
| Exact Mass | 914.29 |
| IUPAC Name | 2-[3,6-bis(2-cyanophenyl)carbazol-9-yl]-5-[3,6-bis(2-isocyanophenyl)carbazol-9-yl]-4-pyridin-4-ylbenzonitrile |
| SMILES | [C-]#[N+]c1ccccc1-c1ccc2c(c1)c1cc(-c3ccccc3[N+]#[C-])ccc1n2-c1cc(C#N)c(-n2c3ccc(-c4ccccc4C#N)cc3c3cc(-c4ccccc4C#N)ccc32)cc1-c1ccncc1 |
| InChI | InChI=1S/C64H34N8/c1-68-57-17-9-7-15-50(57)43-21-25-61-55(33-43)56-34-44(51-16-8-10-18-58(51)69-2)22-26-62(56)72(61)64-35-47(39-67)63(36-52(64)40-27-29-70-30-28-40)71-59-23-19-41(48-13-5-3-11-45(48)37-65)31-53(59)54-32-42(20-24-60(54)71)49-14-6-4-12-46(49)38-66/h3-36H |
| InChIKey | UCJTZIJWHKGFNV-UHFFFAOYSA-N |
| XLogP | 16.33 |
| TPSA | 102.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 915.03 |
| LogP ≤ 5 | 16.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|