C66H34N8 — CID 155646695
4-(3-cyanophenyl)-2,5-bis[2-(2-cyanophenyl)-7-(2-isocyanophenyl)carbazol-9-yl]benzonitrile (PubChem CID 155646695) has the molecular formula C66H34N8 and a molecular weight of 939.05 g/mol. Its IUPAC name is 4-(3-cyanophenyl)-2,5-bis[2-(2-cyanophenyl)-7-(2-isocyanophenyl)carbazol-9-yl]benzonitrile.
| Compound Name | 4-(3-cyanophenyl)-2,5-bis[2-(2-cyanophenyl)-7-(2-isocyanophenyl)carbazol-9-yl]benzonitrile |
|---|---|
| PubChem CID | 155646695 |
| Molecular Formula | C66H34N8 |
| Molecular Weight | 939.05 g/mol |
| Exact Mass | 938.29 |
| IUPAC Name | 4-(3-cyanophenyl)-2,5-bis[2-(2-cyanophenyl)-7-(2-isocyanophenyl)carbazol-9-yl]benzonitrile |
| SMILES | [C-]#[N+]c1ccccc1-c1ccc2c3ccc(-c4ccccc4C#N)cc3n(-c3cc(-c4cccc(C#N)c4)c(-n4c5cc(-c6ccccc6C#N)ccc5c5ccc(-c6ccccc6[N+]#[C-])cc54)cc3C#N)c2c1 |
| InChI | InChI=1S/C66H34N8/c1-71-59-20-9-7-18-52(59)45-24-28-55-54-26-22-43(50-16-5-3-13-47(50)38-68)31-62(54)73(63(55)33-45)61-36-58(42-15-11-12-41(30-42)37-67)66(35-49(61)40-70)74-64-32-44(51-17-6-4-14-48(51)39-69)23-27-56(64)57-29-25-46(34-65(57)74)53-19-8-10-21-60(53)72-2/h3-36H |
| InChIKey | ROMZFIAVYNMPPB-UHFFFAOYSA-N |
| XLogP | 16.80 |
| TPSA | 113.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 939.05 |
| LogP ≤ 5 | 16.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|