C38H19N7 — CID 171739757
2-[3-cyano-4-[3-(2-cyanophenyl)-6-(2-isocyanophenyl)carbazol-9-yl]phenyl]pyrimidine-5-carbonitrile (PubChem CID 171739757) has the molecular formula C38H19N7 and a molecular weight of 573.62 g/mol. Its IUPAC name is 2-[3-cyano-4-[3-(2-cyanophenyl)-6-(2-isocyanophenyl)carbazol-9-yl]phenyl]pyrimidine-5-carbonitrile.
| Compound Name | 2-[3-cyano-4-[3-(2-cyanophenyl)-6-(2-isocyanophenyl)carbazol-9-yl]phenyl]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 171739757 |
| Molecular Formula | C38H19N7 |
| Molecular Weight | 573.62 g/mol |
| Exact Mass | 573.17 |
| IUPAC Name | 2-[3-cyano-4-[3-(2-cyanophenyl)-6-(2-isocyanophenyl)carbazol-9-yl]phenyl]pyrimidine-5-carbonitrile |
| SMILES | [C-]#[N+]c1ccccc1-c1ccc2c(c1)c1cc(-c3ccccc3C#N)ccc1n2-c1ccc(-c2ncc(C#N)cn2)cc1C#N |
| InChI | InChI=1S/C38H19N7/c1-42-34-9-5-4-8-31(34)26-11-15-37-33(18-26)32-17-25(30-7-3-2-6-28(30)20-40)10-14-36(32)45(37)35-13-12-27(16-29(35)21-41)38-43-22-24(19-39)23-44-38/h2-18,22-23H |
| InChIKey | KABCWJBLNJQJQO-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 106.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.62 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|