C40H17N9 — CID 171739730
2-[3-cyano-4-[2-(2-cyano-4-isocyanophenyl)-7-(4-cyano-2-isocyanophenyl)carbazol-9-yl]phenyl]pyrimidine-5-carbonitrile (PubChem CID 171739730) has the molecular formula C40H17N9 and a molecular weight of 623.64 g/mol. Its IUPAC name is 2-[3-cyano-4-[2-(2-cyano-4-isocyanophenyl)-7-(4-cyano-2-isocyanophenyl)carbazol-9-yl]phenyl]pyrimidine-5-carbonitrile.
| Compound Name | 2-[3-cyano-4-[2-(2-cyano-4-isocyanophenyl)-7-(4-cyano-2-isocyanophenyl)carbazol-9-yl]phenyl]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 171739730 |
| Molecular Formula | C40H17N9 |
| Molecular Weight | 623.64 g/mol |
| Exact Mass | 623.16 |
| IUPAC Name | 2-[3-cyano-4-[2-(2-cyano-4-isocyanophenyl)-7-(4-cyano-2-isocyanophenyl)carbazol-9-yl]phenyl]pyrimidine-5-carbonitrile |
| SMILES | [C-]#[N+]c1ccc(-c2ccc3c4ccc(-c5ccc(C#N)cc5[N+]#[C-])cc4n(-c4ccc(-c5ncc(C#N)cn5)cc4C#N)c3c2)c(C#N)c1 |
| InChI | InChI=1S/C40H17N9/c1-45-31-7-11-32(29(15-31)20-43)26-4-9-34-35-10-5-27(33-8-3-24(18-41)13-36(33)46-2)17-39(35)49(38(34)16-26)37-12-6-28(14-30(37)21-44)40-47-22-25(19-42)23-48-40/h3-17,22-23H |
| InChIKey | AYZZRXBVVZEAII-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 134.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.64 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|