C64H38N8 — CID 156679481
2-[9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-[3-[3-(2-isocyanophenyl)carbazol-9-yl]-2-pyridinyl]phenyl]carbazol-3-yl]benzonitrile (PubChem CID 156679481) has the molecular formula C64H38N8 and a molecular weight of 919.06 g/mol. Its IUPAC name is 2-[9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-[3-[3-(2-isocyanophenyl)carbazol-9-yl]-2-pyridinyl]phenyl]carbazol-3-yl]benzonitrile.
| Compound Name | 2-[9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-[3-[3-(2-isocyanophenyl)carbazol-9-yl]-2-pyridinyl]phenyl]carbazol-3-yl]benzonitrile |
|---|---|
| PubChem CID | 156679481 |
| Molecular Formula | C64H38N8 |
| Molecular Weight | 919.06 g/mol |
| Exact Mass | 918.32 |
| IUPAC Name | 2-[9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-[3-[3-(2-isocyanophenyl)carbazol-9-yl]-2-pyridinyl]phenyl]carbazol-3-yl]benzonitrile |
| SMILES | [C-]#[N+]c1ccccc1-c1ccc2c(c1)c1ccccc1n2-c1cccnc1-c1cc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)ccc1-n1c2ccccc2c2cc(-c3ccccc3C#N)ccc21 |
| InChI | InChI=1S/C64H38N8/c1-66-54-26-13-10-23-48(54)44-31-34-58-52(38-44)50-25-12-15-28-56(50)72(58)60-29-16-36-67-61(60)53-39-45(64-69-62(41-17-4-2-5-18-41)68-63(70-64)42-19-6-3-7-20-42)32-35-59(53)71-55-27-14-11-24-49(55)51-37-43(30-33-57(51)71)47-22-9-8-21-46(47)40-65/h2-39H |
| InChIKey | UDSDNHVMKQFCOI-UHFFFAOYSA-N |
| XLogP | 15.89 |
| TPSA | 89.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.06 |
| LogP ≤ 5 | 15.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|