C60H37N9 — CID 166968227
3-[9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-pyridinyl]phenyl]carbazol-3-yl]benzonitrile (PubChem CID 166968227) has the molecular formula C60H37N9 and a molecular weight of 884.02 g/mol. Its IUPAC name is 3-[9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-pyridinyl]phenyl]carbazol-3-yl]benzonitrile.
| Compound Name | 3-[9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-pyridinyl]phenyl]carbazol-3-yl]benzonitrile |
|---|---|
| PubChem CID | 166968227 |
| Molecular Formula | C60H37N9 |
| Molecular Weight | 884.02 g/mol |
| Exact Mass | 883.32 |
| IUPAC Name | 3-[9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-pyridinyl]phenyl]carbazol-3-yl]benzonitrile |
| SMILES | N#Cc1cccc(-c2ccc3c(c2)c2ccccc2n3-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc2-c2ncccc2-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C60H37N9/c61-38-39-17-15-26-44(35-39)45-30-32-52-49(36-45)47-27-13-14-29-51(47)69(52)53-33-31-46(59-65-55(40-18-5-1-6-19-40)63-56(66-59)41-20-7-2-8-21-41)37-50(53)54-48(28-16-34-62-54)60-67-57(42-22-9-3-10-23-42)64-58(68-60)43-24-11-4-12-25-43/h1-37H |
| InChIKey | BYQKJQBGARDFJI-UHFFFAOYSA-N |
| XLogP | 13.76 |
| TPSA | 118.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.02 |
| LogP ≤ 5 | 13.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |