C75H41N9 — CID 162119979
2,6-bis[3-(2-cyanophenyl)-6-(2-isocyanophenyl)carbazol-9-yl]-4-(4,6-diphenylpyrimidin-2-yl)benzonitrile (PubChem CID 162119979) has the molecular formula C75H41N9 and a molecular weight of 1068.22 g/mol. Its IUPAC name is 2,6-bis[3-(2-cyanophenyl)-6-(2-isocyanophenyl)carbazol-9-yl]-4-(4,6-diphenylpyrimidin-2-yl)benzonitrile.
| Compound Name | 2,6-bis[3-(2-cyanophenyl)-6-(2-isocyanophenyl)carbazol-9-yl]-4-(4,6-diphenylpyrimidin-2-yl)benzonitrile |
|---|---|
| PubChem CID | 162119979 |
| Molecular Formula | C75H41N9 |
| Molecular Weight | 1068.22 g/mol |
| Exact Mass | 1067.35 |
| IUPAC Name | 2,6-bis[3-(2-cyanophenyl)-6-(2-isocyanophenyl)carbazol-9-yl]-4-(4,6-diphenylpyrimidin-2-yl)benzonitrile |
| SMILES | [C-]#[N+]c1ccccc1-c1ccc2c(c1)c1cc(-c3ccccc3C#N)ccc1n2-c1cc(-c2nc(-c3ccccc3)cc(-c3ccccc3)n2)cc(-n2c3ccc(-c4ccccc4C#N)cc3c3cc(-c4ccccc4[N+]#[C-])ccc32)c1C#N |
| InChI | InChI=1S/C75H41N9/c1-79-65-27-15-13-25-58(65)51-31-35-71-62(39-51)60-37-49(56-23-11-9-21-53(56)44-76)29-33-69(60)83(71)73-41-55(75-81-67(47-17-5-3-6-18-47)43-68(82-75)48-19-7-4-8-20-48)42-74(64(73)46-78)84-70-34-30-50(57-24-12-10-22-54(57)45-77)38-61(70)63-40-52(32-36-72(63)84)59-26-14-16-28-66(59)80-2/h3-43H |
| InChIKey | VZBIDZJCBRFUEU-UHFFFAOYSA-N |
| XLogP | 19.06 |
| TPSA | 115.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1068.22 |
| LogP ≤ 5 | 19.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|