C53H32N4 — CID 58954366
4-[bis(4-cyano-3-phenylphenyl)-(4-isocyano-3-phenylphenyl)methyl]-2-phenylbenzonitrile (PubChem CID 58954366) has the molecular formula C53H32N4 and a molecular weight of 724.87 g/mol. Its IUPAC name is 4-[bis(4-cyano-3-phenylphenyl)-(4-isocyano-3-phenylphenyl)methyl]-2-phenylbenzonitrile.
| Compound Name | 4-[bis(4-cyano-3-phenylphenyl)-(4-isocyano-3-phenylphenyl)methyl]-2-phenylbenzonitrile |
|---|---|
| PubChem CID | 58954366 |
| Molecular Formula | C53H32N4 |
| Molecular Weight | 724.87 g/mol |
| Exact Mass | 724.26 |
| IUPAC Name | 4-[bis(4-cyano-3-phenylphenyl)-(4-isocyano-3-phenylphenyl)methyl]-2-phenylbenzonitrile |
| SMILES | [C-]#[N+]c1ccc(C(c2ccc(C#N)c(-c3ccccc3)c2)(c2ccc(C#N)c(-c3ccccc3)c2)c2ccc(C#N)c(-c3ccccc3)c2)cc1-c1ccccc1 |
| InChI | InChI=1S/C53H32N4/c1-57-52-29-28-47(33-51(52)40-20-12-5-13-21-40)53(44-25-22-41(34-54)48(30-44)37-14-6-2-7-15-37,45-26-23-42(35-55)49(31-45)38-16-8-3-9-17-38)46-27-24-43(36-56)50(32-46)39-18-10-4-11-19-39/h2-33H |
| InChIKey | FVDMLCOMYXEOBR-UHFFFAOYSA-N |
| XLogP | 12.90 |
| TPSA | 75.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.87 |
| LogP ≤ 5 | 12.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|