C18H19N — CID 122188193
2-(4-tert-butylphenyl)-1-isocyano-4-methylbenzene (PubChem CID 122188193) has the molecular formula C18H19N and a molecular weight of 249.36 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-1-isocyano-4-methylbenzene.
| Compound Name | 2-(4-tert-butylphenyl)-1-isocyano-4-methylbenzene |
|---|---|
| PubChem CID | 122188193 |
| Molecular Formula | C18H19N |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 2-(4-tert-butylphenyl)-1-isocyano-4-methylbenzene |
| SMILES | [C-]#[N+]c1ccc(C)cc1-c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H19N/c1-13-6-11-17(19-5)16(12-13)14-7-9-15(10-8-14)18(2,3)4/h6-12H,1-4H3 |
| InChIKey | ZMOVFZPPALLFHE-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|