C12H12N2 — CID 59436684
4-tert-butyl-1,2-diisocyanobenzene (PubChem CID 59436684) has the molecular formula C12H12N2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 4-tert-butyl-1,2-diisocyanobenzene.
| Compound Name | 4-tert-butyl-1,2-diisocyanobenzene |
|---|---|
| PubChem CID | 59436684 |
| Molecular Formula | C12H12N2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 4-tert-butyl-1,2-diisocyanobenzene |
| SMILES | [C-]#[N+]c1ccc(C(C)(C)C)cc1[N+]#[C-] |
| InChI | InChI=1S/C12H12N2/c1-12(2,3)9-6-7-10(13-4)11(8-9)14-5/h6-8H,1-3H3 |
| InChIKey | PVXXAKBZSOEUSA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 8.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|