About 3,4-diisocyanophenol
3,4-diisocyanophenol (PubChem CID 59946726) has the molecular formula C8H4N2O
and a molecular weight of 144.13 g/mol. Its IUPAC name is 3,4-diisocyanophenol.
Molecular Properties
| Compound Name | 3,4-diisocyanophenol |
| PubChem CID | 59946726 |
| Molecular Formula | C8H4N2O |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.03 |
| IUPAC Name | 3,4-diisocyanophenol |
| SMILES | [C-]#[N+]c1ccc(O)cc1[N+]#[C-] |
| InChI | InChI=1S/C8H4N2O/c1-9-7-4-3-6(11)5-8(7)10-2/h3-5,11H |
| InChIKey | MMXRDYXIBLBVQX-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 28.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3,4-diisocyanophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diisocyanophenol?
The IUPAC name of 3,4-diisocyanophenol (CID 59946726) is 3,4-diisocyanophenol.
What is the SMILES notation for 3,4-diisocyanophenol?
The canonical SMILES for 3,4-diisocyanophenol is [C-]#[N+]c1ccc(O)cc1[N+]#[C-].
What is the InChIKey of 3,4-diisocyanophenol?
The InChIKey is MMXRDYXIBLBVQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4N2O/c1-9-7-4-3-6(11)5-8(7)10-2/h3-5,11H.
What are the key properties of 3,4-diisocyanophenol?
3,4-diisocyanophenol has a molecular weight of 144.13 g/mol, XLogP of 2.49, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diisocyanophenol is sourced from PubChem (CID 59946726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).