C22H16N2 — CID 178078248
1,2-diisocyano-4,5-bis(4-methylphenyl)benzene (PubChem CID 178078248) has the molecular formula C22H16N2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 1,2-diisocyano-4,5-bis(4-methylphenyl)benzene.
| Compound Name | 1,2-diisocyano-4,5-bis(4-methylphenyl)benzene |
|---|---|
| PubChem CID | 178078248 |
| Molecular Formula | C22H16N2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 1,2-diisocyano-4,5-bis(4-methylphenyl)benzene |
| SMILES | [C-]#[N+]c1cc(-c2ccc(C)cc2)c(-c2ccc(C)cc2)cc1[N+]#[C-] |
| InChI | InChI=1S/C22H16N2/c1-15-5-9-17(10-6-15)19-13-21(23-3)22(24-4)14-20(19)18-11-7-16(2)8-12-18/h5-14H,1-2H3 |
| InChIKey | BJXOTWISKUDLEW-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 8.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|