C20H12N2 — CID 91137107
1,2-diisocyano-3-(4-phenylphenyl)benzene (PubChem CID 91137107) has the molecular formula C20H12N2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 1,2-diisocyano-3-(4-phenylphenyl)benzene.
| Compound Name | 1,2-diisocyano-3-(4-phenylphenyl)benzene |
|---|---|
| PubChem CID | 91137107 |
| Molecular Formula | C20H12N2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 1,2-diisocyano-3-(4-phenylphenyl)benzene |
| SMILES | [C-]#[N+]c1cccc(-c2ccc(-c3ccccc3)cc2)c1[N+]#[C-] |
| InChI | InChI=1S/C20H12N2/c1-21-19-10-6-9-18(20(19)22-2)17-13-11-16(12-14-17)15-7-4-3-5-8-15/h3-14H |
| InChIKey | RAJLSGXADLYJMG-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 8.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|