About 3-phenylbenzene-1,2-didiazonium
3-phenylbenzene-1,2-didiazonium (PubChem CID 54366733) has the molecular formula C12H8N4+2
and a molecular weight of 208.22 g/mol. Its IUPAC name is 3-phenylbenzene-1,2-didiazonium.
Molecular Properties
| Compound Name | 3-phenylbenzene-1,2-didiazonium |
| PubChem CID | 54366733 |
| Molecular Formula | C12H8N4+2 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 3-phenylbenzene-1,2-didiazonium |
| SMILES | N#[N+]c1cccc(-c2ccccc2)c1[N+]#N |
| InChI | InChI=1S/C12H8N4/c13-15-11-8-4-7-10(12(11)16-14)9-5-2-1-3-6-9/h1-8H/q+2 |
| InChIKey | UQHRWCLOVYZKFT-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 56.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylbenzene-1,2-didiazonium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylbenzene-1,2-didiazonium?
The IUPAC name of 3-phenylbenzene-1,2-didiazonium (CID 54366733) is 3-phenylbenzene-1,2-didiazonium.
What is the SMILES notation for 3-phenylbenzene-1,2-didiazonium?
The canonical SMILES for 3-phenylbenzene-1,2-didiazonium is N#[N+]c1cccc(-c2ccccc2)c1[N+]#N.
What is the InChIKey of 3-phenylbenzene-1,2-didiazonium?
The InChIKey is UQHRWCLOVYZKFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N4/c13-15-11-8-4-7-10(12(11)16-14)9-5-2-1-3-6-9/h1-8H/q+2.
What are the key properties of 3-phenylbenzene-1,2-didiazonium?
3-phenylbenzene-1,2-didiazonium has a molecular weight of 208.22 g/mol, XLogP of 4.32, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylbenzene-1,2-didiazonium is sourced from PubChem (CID 54366733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).