C18H12Cl2N4O8 — CID 88746535
2-(2-phenylphenyl)benzene-1,3-didiazonium diperchlorate (PubChem CID 88746535) has the molecular formula C18H12Cl2N4O8 and a molecular weight of 483.22 g/mol. Its IUPAC name is 2-(2-phenylphenyl)benzene-1,3-didiazonium diperchlorate.
| Compound Name | 2-(2-phenylphenyl)benzene-1,3-didiazonium diperchlorate |
|---|---|
| PubChem CID | 88746535 |
| Molecular Formula | C18H12Cl2N4O8 |
| Molecular Weight | 483.22 g/mol |
| Exact Mass | 482.00 |
| IUPAC Name | 2-(2-phenylphenyl)benzene-1,3-didiazonium diperchlorate |
| SMILES | N#[N+]c1cccc([N+]#N)c1-c1ccccc1-c1ccccc1.[O-][Cl+3]([O-])([O-])[O-].[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C18H12N4.2ClHO4/c19-21-16-11-6-12-17(22-20)18(16)15-10-5-4-9-14(15)13-7-2-1-3-8-13;2*2-1(3,4)5/h1-12H;2*(H,2,3,4,5)/q+2;;/p-2 |
| InChIKey | BWCUEGXNPWVMEZ-UHFFFAOYSA-L |
| XLogP | -3.52 |
| TPSA | 240.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.22 |
| LogP ≤ 5 | -3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|