About 2-(2-phenylphenyl)benzene-1,3-didiazonium
2-(2-phenylphenyl)benzene-1,3-didiazonium (PubChem CID 88746536) has the molecular formula C18H12N4+2
and a molecular weight of 284.32 g/mol. Its IUPAC name is 2-(2-phenylphenyl)benzene-1,3-didiazonium.
Molecular Properties
| Compound Name | 2-(2-phenylphenyl)benzene-1,3-didiazonium |
| PubChem CID | 88746536 |
| Molecular Formula | C18H12N4+2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 2-(2-phenylphenyl)benzene-1,3-didiazonium |
| SMILES | N#[N+]c1cccc([N+]#N)c1-c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C18H12N4/c19-21-16-11-6-12-17(22-20)18(16)15-10-5-4-9-14(15)13-7-2-1-3-8-13/h1-12H/q+2 |
| InChIKey | DAWLEXPSMKKHHE-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 56.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-phenylphenyl)benzene-1,3-didiazonium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-phenylphenyl)benzene-1,3-didiazonium?
The IUPAC name of 2-(2-phenylphenyl)benzene-1,3-didiazonium (CID 88746536) is 2-(2-phenylphenyl)benzene-1,3-didiazonium.
What is the SMILES notation for 2-(2-phenylphenyl)benzene-1,3-didiazonium?
The canonical SMILES for 2-(2-phenylphenyl)benzene-1,3-didiazonium is N#[N+]c1cccc([N+]#N)c1-c1ccccc1-c1ccccc1.
What is the InChIKey of 2-(2-phenylphenyl)benzene-1,3-didiazonium?
The InChIKey is DAWLEXPSMKKHHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12N4/c19-21-16-11-6-12-17(22-20)18(16)15-10-5-4-9-14(15)13-7-2-1-3-8-13/h1-12H/q+2.
What are the key properties of 2-(2-phenylphenyl)benzene-1,3-didiazonium?
2-(2-phenylphenyl)benzene-1,3-didiazonium has a molecular weight of 284.32 g/mol, XLogP of 5.99, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-phenylphenyl)benzene-1,3-didiazonium is sourced from PubChem (CID 88746536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).