About 4-phenylbenzene-1,3-didiazonium dichloride
4-phenylbenzene-1,3-didiazonium dichloride (PubChem CID 88741124) has the molecular formula C12H8Cl2N4
and a molecular weight of 279.13 g/mol. Its IUPAC name is 4-phenylbenzene-1,3-didiazonium dichloride.
Molecular Properties
| Compound Name | 4-phenylbenzene-1,3-didiazonium dichloride |
| PubChem CID | 88741124 |
| Molecular Formula | C12H8Cl2N4 |
| Molecular Weight | 279.13 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | 4-phenylbenzene-1,3-didiazonium dichloride |
| SMILES | N#[N+]c1ccc(-c2ccccc2)c([N+]#N)c1.[Cl-].[Cl-] |
| InChI | InChI=1S/C12H8N4.2ClH/c13-15-10-6-7-11(12(8-10)16-14)9-4-2-1-3-5-9;;/h1-8H;2*1H/q+2;;/p-2 |
| InChIKey | OKFQPJOJLWYNDA-UHFFFAOYSA-L |
| XLogP | -1.67 |
| TPSA | 56.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.13 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-phenylbenzene-1,3-didiazonium dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylbenzene-1,3-didiazonium dichloride?
The IUPAC name of 4-phenylbenzene-1,3-didiazonium dichloride (CID 88741124) is 4-phenylbenzene-1,3-didiazonium dichloride.
What is the SMILES notation for 4-phenylbenzene-1,3-didiazonium dichloride?
The canonical SMILES for 4-phenylbenzene-1,3-didiazonium dichloride is N#[N+]c1ccc(-c2ccccc2)c([N+]#N)c1.[Cl-].[Cl-].
What is the InChIKey of 4-phenylbenzene-1,3-didiazonium dichloride?
The InChIKey is OKFQPJOJLWYNDA-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H8N4.2ClH/c13-15-10-6-7-11(12(8-10)16-14)9-4-2-1-3-5-9;;/h1-8H;2*1H/q+2;;/p-2.
What are the key properties of 4-phenylbenzene-1,3-didiazonium dichloride?
4-phenylbenzene-1,3-didiazonium dichloride has a molecular weight of 279.13 g/mol, XLogP of -1.67, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylbenzene-1,3-didiazonium dichloride is sourced from PubChem (CID 88741124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).