C24H17BF4N2 — CID 134929307
2,4,6-triphenylbenzenediazonium tetrafluoroborate (PubChem CID 134929307) has the molecular formula C24H17BF4N2 and a molecular weight of 420.22 g/mol. Its IUPAC name is 2,4,6-triphenylbenzenediazonium tetrafluoroborate.
| Compound Name | 2,4,6-triphenylbenzenediazonium tetrafluoroborate |
|---|---|
| PubChem CID | 134929307 |
| Molecular Formula | C24H17BF4N2 |
| Molecular Weight | 420.22 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 2,4,6-triphenylbenzenediazonium tetrafluoroborate |
| SMILES | F[B-](F)(F)F.N#[N+]c1c(-c2ccccc2)cc(-c2ccccc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C24H17N2.BF4/c25-26-24-22(19-12-6-2-7-13-19)16-21(18-10-4-1-5-11-18)17-23(24)20-14-8-3-9-15-20;2-1(3,4)5/h1-17H;/q+1;-1 |
| InChIKey | KAOBCFVMYKNLNZ-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.22 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|