C24H16N2 — CID 59294441
6-(2-isocyanophenyl)-2,3-diphenylpyridine (PubChem CID 59294441) has the molecular formula C24H16N2 and a molecular weight of 332.41 g/mol. Its IUPAC name is 6-(2-isocyanophenyl)-2,3-diphenylpyridine.
| Compound Name | 6-(2-isocyanophenyl)-2,3-diphenylpyridine |
|---|---|
| PubChem CID | 59294441 |
| Molecular Formula | C24H16N2 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 6-(2-isocyanophenyl)-2,3-diphenylpyridine |
| SMILES | [C-]#[N+]c1ccccc1-c1ccc(-c2ccccc2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C24H16N2/c1-25-22-15-9-8-14-21(22)23-17-16-20(18-10-4-2-5-11-18)24(26-23)19-12-6-3-7-13-19/h2-17H |
| InChIKey | YVZJXQJXGNIUPM-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 17.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|