C40H35N3 — CID 140903204
2-[4-(3,6-ditert-butylcarbazol-9-yl)-2-phenylphenyl]-3-isocyanobenzonitrile (PubChem CID 140903204) has the molecular formula C40H35N3 and a molecular weight of 557.74 g/mol. Its IUPAC name is 2-[4-(3,6-ditert-butylcarbazol-9-yl)-2-phenylphenyl]-3-isocyanobenzonitrile.
| Compound Name | 2-[4-(3,6-ditert-butylcarbazol-9-yl)-2-phenylphenyl]-3-isocyanobenzonitrile |
|---|---|
| PubChem CID | 140903204 |
| Molecular Formula | C40H35N3 |
| Molecular Weight | 557.74 g/mol |
| Exact Mass | 557.28 |
| IUPAC Name | 2-[4-(3,6-ditert-butylcarbazol-9-yl)-2-phenylphenyl]-3-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cccc(C#N)c1-c1ccc(-n2c3ccc(C(C)(C)C)cc3c3cc(C(C)(C)C)ccc32)cc1-c1ccccc1 |
| InChI | InChI=1S/C40H35N3/c1-39(2,3)28-16-20-36-33(22-28)34-23-29(40(4,5)6)17-21-37(34)43(36)30-18-19-31(32(24-30)26-12-9-8-10-13-26)38-27(25-41)14-11-15-35(38)42-7/h8-24H,1-6H3 |
| InChIKey | JIOZUZLULPBJQK-UHFFFAOYSA-N |
| XLogP | 11.14 |
| TPSA | 33.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.74 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|