C32H19N3 — CID 155645732
2-(7,9-diphenylcarbazol-3-yl)-3-isocyanobenzonitrile (PubChem CID 155645732) has the molecular formula C32H19N3 and a molecular weight of 445.53 g/mol. Its IUPAC name is 2-(7,9-diphenylcarbazol-3-yl)-3-isocyanobenzonitrile.
| Compound Name | 2-(7,9-diphenylcarbazol-3-yl)-3-isocyanobenzonitrile |
|---|---|
| PubChem CID | 155645732 |
| Molecular Formula | C32H19N3 |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 2-(7,9-diphenylcarbazol-3-yl)-3-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cccc(C#N)c1-c1ccc2c(c1)c1ccc(-c3ccccc3)cc1n2-c1ccccc1 |
| InChI | InChI=1S/C32H19N3/c1-34-29-14-8-11-25(21-33)32(29)24-16-18-30-28(19-24)27-17-15-23(22-9-4-2-5-10-22)20-31(27)35(30)26-12-6-3-7-13-26/h2-20H |
| InChIKey | CNSBIQXVKHGZNV-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 33.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|