C33H18N4 — CID 155645760
2-[8-(2-cyanophenyl)-9-phenylcarbazol-3-yl]-3-isocyanobenzonitrile (PubChem CID 155645760) has the molecular formula C33H18N4 and a molecular weight of 470.54 g/mol. Its IUPAC name is 2-[8-(2-cyanophenyl)-9-phenylcarbazol-3-yl]-3-isocyanobenzonitrile.
| Compound Name | 2-[8-(2-cyanophenyl)-9-phenylcarbazol-3-yl]-3-isocyanobenzonitrile |
|---|---|
| PubChem CID | 155645760 |
| Molecular Formula | C33H18N4 |
| Molecular Weight | 470.54 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 2-[8-(2-cyanophenyl)-9-phenylcarbazol-3-yl]-3-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cccc(C#N)c1-c1ccc2c(c1)c1cccc(-c3ccccc3C#N)c1n2-c1ccccc1 |
| InChI | InChI=1S/C33H18N4/c1-36-30-16-7-10-24(21-35)32(30)22-17-18-31-29(19-22)28-15-8-14-27(26-13-6-5-9-23(26)20-34)33(28)37(31)25-11-3-2-4-12-25/h2-19H |
| InChIKey | PFQXEYFGFWIQKS-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 56.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.54 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|