C34H17N5 — CID 155645689
2-[5-(2-cyano-6-isocyanophenyl)-9-phenylcarbazol-1-yl]benzene-1,3-dicarbonitrile (PubChem CID 155645689) has the molecular formula C34H17N5 and a molecular weight of 495.55 g/mol. Its IUPAC name is 2-[5-(2-cyano-6-isocyanophenyl)-9-phenylcarbazol-1-yl]benzene-1,3-dicarbonitrile.
| Compound Name | 2-[5-(2-cyano-6-isocyanophenyl)-9-phenylcarbazol-1-yl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 155645689 |
| Molecular Formula | C34H17N5 |
| Molecular Weight | 495.55 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | 2-[5-(2-cyano-6-isocyanophenyl)-9-phenylcarbazol-1-yl]benzene-1,3-dicarbonitrile |
| SMILES | [C-]#[N+]c1cccc(C#N)c1-c1cccc2c1c1cccc(-c3c(C#N)cccc3C#N)c1n2-c1ccccc1 |
| InChI | InChI=1S/C34H17N5/c1-38-29-17-6-11-24(21-37)32(29)26-14-8-18-30-33(26)28-16-7-15-27(31-22(19-35)9-5-10-23(31)20-36)34(28)39(30)25-12-3-2-4-13-25/h2-18H |
| InChIKey | ICAUXNPNWHZNKM-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 80.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.55 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|