C43H22N8 — CID 155645615
2-[8-(2-cyano-6-isocyanophenyl)-9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-1-yl]benzene-1,3-dicarbonitrile (PubChem CID 155645615) has the molecular formula C43H22N8 and a molecular weight of 650.71 g/mol. Its IUPAC name is 2-[8-(2-cyano-6-isocyanophenyl)-9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-1-yl]benzene-1,3-dicarbonitrile.
| Compound Name | 2-[8-(2-cyano-6-isocyanophenyl)-9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-1-yl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 155645615 |
| Molecular Formula | C43H22N8 |
| Molecular Weight | 650.71 g/mol |
| Exact Mass | 650.20 |
| IUPAC Name | 2-[8-(2-cyano-6-isocyanophenyl)-9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-1-yl]benzene-1,3-dicarbonitrile |
| SMILES | [C-]#[N+]c1cccc(C#N)c1-c1cccc2c3cccc(-c4c(C#N)cccc4C#N)c3n(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c12 |
| InChI | InChI=1S/C43H22N8/c1-47-36-23-9-18-31(26-46)38(36)35-22-11-20-33-32-19-10-21-34(37-29(24-44)16-8-17-30(37)25-45)39(32)51(40(33)35)43-49-41(27-12-4-2-5-13-27)48-42(50-43)28-14-6-3-7-15-28/h2-23H |
| InChIKey | CQLMADZDVVNSLT-UHFFFAOYSA-N |
| XLogP | 9.80 |
| TPSA | 119.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.71 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|