C48H42N4 — CID 140877357
2-[2-(3,6-ditert-butylcarbazol-9-yl)-9-(2,6-dimethylphenyl)carbazol-1-yl]-3-isocyanobenzonitrile (PubChem CID 140877357) has the molecular formula C48H42N4 and a molecular weight of 674.89 g/mol. Its IUPAC name is 2-[2-(3,6-ditert-butylcarbazol-9-yl)-9-(2,6-dimethylphenyl)carbazol-1-yl]-3-isocyanobenzonitrile.
| Compound Name | 2-[2-(3,6-ditert-butylcarbazol-9-yl)-9-(2,6-dimethylphenyl)carbazol-1-yl]-3-isocyanobenzonitrile |
|---|---|
| PubChem CID | 140877357 |
| Molecular Formula | C48H42N4 |
| Molecular Weight | 674.89 g/mol |
| Exact Mass | 674.34 |
| IUPAC Name | 2-[2-(3,6-ditert-butylcarbazol-9-yl)-9-(2,6-dimethylphenyl)carbazol-1-yl]-3-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cccc(C#N)c1-c1c(-n2c3ccc(C(C)(C)C)cc3c3cc(C(C)(C)C)ccc32)ccc2c3ccccc3n(-c3c(C)cccc3C)c12 |
| InChI | InChI=1S/C48H42N4/c1-29-14-12-15-30(2)45(29)52-39-19-11-10-17-34(39)35-22-25-42(44(46(35)52)43-31(28-49)16-13-18-38(43)50-9)51-40-23-20-32(47(3,4)5)26-36(40)37-27-33(48(6,7)8)21-24-41(37)51/h10-27H,1-8H3 |
| InChIKey | RMUPJAZJRMZPIB-UHFFFAOYSA-N |
| XLogP | 13.18 |
| TPSA | 38.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.89 |
| LogP ≤ 5 | 13.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|