C47H29F3N4 — CID 157400805
4-[2-[2-isocyano-6-[3-(trifluoromethyl)carbazol-9-yl]phenyl]-3-(3-methylcarbazol-9-yl)phenyl]-3-methylbenzonitrile (PubChem CID 157400805) has the molecular formula C47H29F3N4 and a molecular weight of 706.77 g/mol. Its IUPAC name is 4-[2-[2-isocyano-6-[3-(trifluoromethyl)carbazol-9-yl]phenyl]-3-(3-methylcarbazol-9-yl)phenyl]-3-methylbenzonitrile.
| Compound Name | 4-[2-[2-isocyano-6-[3-(trifluoromethyl)carbazol-9-yl]phenyl]-3-(3-methylcarbazol-9-yl)phenyl]-3-methylbenzonitrile |
|---|---|
| PubChem CID | 157400805 |
| Molecular Formula | C47H29F3N4 |
| Molecular Weight | 706.77 g/mol |
| Exact Mass | 706.23 |
| IUPAC Name | 4-[2-[2-isocyano-6-[3-(trifluoromethyl)carbazol-9-yl]phenyl]-3-(3-methylcarbazol-9-yl)phenyl]-3-methylbenzonitrile |
| SMILES | [C-]#[N+]c1cccc(-n2c3ccccc3c3cc(C(F)(F)F)ccc32)c1-c1c(-c2ccc(C#N)cc2C)cccc1-n1c2ccccc2c2cc(C)ccc21 |
| InChI | InChI=1S/C47H29F3N4/c1-28-18-22-41-36(24-28)33-10-4-6-14-39(33)53(41)43-16-8-12-35(32-21-19-30(27-51)25-29(32)2)45(43)46-38(52-3)13-9-17-44(46)54-40-15-7-5-11-34(40)37-26-31(47(48,49)50)20-23-42(37)54/h4-26H,1-2H3 |
| InChIKey | QEENXYHSIXEUBK-UHFFFAOYSA-N |
| XLogP | 13.27 |
| TPSA | 38.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.77 |
| LogP ≤ 5 | 13.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|