C41H25F3N4 — CID 153302919
4-[2-isocyano-4-(trifluoromethyl)phenyl]-3,5-bis(2-methylcarbazol-9-yl)benzonitrile (PubChem CID 153302919) has the molecular formula C41H25F3N4 and a molecular weight of 630.67 g/mol. Its IUPAC name is 4-[2-isocyano-4-(trifluoromethyl)phenyl]-3,5-bis(2-methylcarbazol-9-yl)benzonitrile.
| Compound Name | 4-[2-isocyano-4-(trifluoromethyl)phenyl]-3,5-bis(2-methylcarbazol-9-yl)benzonitrile |
|---|---|
| PubChem CID | 153302919 |
| Molecular Formula | C41H25F3N4 |
| Molecular Weight | 630.67 g/mol |
| Exact Mass | 630.20 |
| IUPAC Name | 4-[2-isocyano-4-(trifluoromethyl)phenyl]-3,5-bis(2-methylcarbazol-9-yl)benzonitrile |
| SMILES | [C-]#[N+]c1cc(C(F)(F)F)ccc1-c1c(-n2c3ccccc3c3ccc(C)cc32)cc(C#N)cc1-n1c2ccccc2c2ccc(C)cc21 |
| InChI | InChI=1S/C41H25F3N4/c1-24-12-15-30-28-8-4-6-10-34(28)47(36(30)18-24)38-20-26(23-45)21-39(40(38)32-17-14-27(41(42,43)44)22-33(32)46-3)48-35-11-7-5-9-29(35)31-16-13-25(2)19-37(31)48/h4-22H,1-2H3 |
| InChIKey | LJVJIXRKKPMETA-UHFFFAOYSA-N |
| XLogP | 11.61 |
| TPSA | 38.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.67 |
| LogP ≤ 5 | 11.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|