C75H61F3N4 — CID 153302792
3,5-bis[2,7-bis(2,4,6-trimethylphenyl)carbazol-9-yl]-4-[2-isocyano-4-(trifluoromethyl)phenyl]benzonitrile (PubChem CID 153302792) has the molecular formula C75H61F3N4 and a molecular weight of 1075.33 g/mol. Its IUPAC name is 3,5-bis[2,7-bis(2,4,6-trimethylphenyl)carbazol-9-yl]-4-[2-isocyano-4-(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 3,5-bis[2,7-bis(2,4,6-trimethylphenyl)carbazol-9-yl]-4-[2-isocyano-4-(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 153302792 |
| Molecular Formula | C75H61F3N4 |
| Molecular Weight | 1075.33 g/mol |
| Exact Mass | 1074.48 |
| IUPAC Name | 3,5-bis[2,7-bis(2,4,6-trimethylphenyl)carbazol-9-yl]-4-[2-isocyano-4-(trifluoromethyl)phenyl]benzonitrile |
| SMILES | [C-]#[N+]c1cc(C(F)(F)F)ccc1-c1c(-n2c3cc(-c4c(C)cc(C)cc4C)ccc3c3ccc(-c4c(C)cc(C)cc4C)cc32)cc(C#N)cc1-n1c2cc(-c3c(C)cc(C)cc3C)ccc2c2ccc(-c3c(C)cc(C)cc3C)cc21 |
| InChI | InChI=1S/C75H61F3N4/c1-40-24-44(5)70(45(6)25-40)53-14-19-58-59-20-15-54(71-46(7)26-41(2)27-47(71)8)35-65(59)81(64(58)34-53)68-32-52(39-79)33-69(74(68)62-23-18-57(75(76,77)78)38-63(62)80-13)82-66-36-55(72-48(9)28-42(3)29-49(72)10)16-21-60(66)61-22-17-56(37-67(61)82)73-50(11)30-43(4)31-51(73)12/h14-38H,1-12H3 |
| InChIKey | XELPSIGNFQTWMS-UHFFFAOYSA-N |
| XLogP | 21.36 |
| TPSA | 38.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1075.33 |
| LogP ≤ 5 | 21.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|