C71H44F12N4 — CID 161387011
3,5-bis[2,7-bis[3-methyl-5-(trifluoromethyl)phenyl]carbazol-9-yl]-4-(4-cyano-2-methylphenyl)benzonitrile (PubChem CID 161387011) has the molecular formula C71H44F12N4 and a molecular weight of 1181.14 g/mol. Its IUPAC name is 3,5-bis[2,7-bis[3-methyl-5-(trifluoromethyl)phenyl]carbazol-9-yl]-4-(4-cyano-2-methylphenyl)benzonitrile.
| Compound Name | 3,5-bis[2,7-bis[3-methyl-5-(trifluoromethyl)phenyl]carbazol-9-yl]-4-(4-cyano-2-methylphenyl)benzonitrile |
|---|---|
| PubChem CID | 161387011 |
| Molecular Formula | C71H44F12N4 |
| Molecular Weight | 1181.14 g/mol |
| Exact Mass | 1180.34 |
| IUPAC Name | 3,5-bis[2,7-bis[3-methyl-5-(trifluoromethyl)phenyl]carbazol-9-yl]-4-(4-cyano-2-methylphenyl)benzonitrile |
| SMILES | Cc1cc(-c2ccc3c4ccc(-c5cc(C)cc(C(F)(F)F)c5)cc4n(-c4cc(C#N)cc(-n5c6cc(-c7cc(C)cc(C(F)(F)F)c7)ccc6c6ccc(-c7cc(C)cc(C(F)(F)F)c7)cc65)c4-c4ccc(C#N)cc4C)c3c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C71H44F12N4/c1-37-16-48(27-52(20-37)68(72,73)74)44-7-12-57-58-13-8-45(49-17-38(2)21-53(28-49)69(75,76)77)32-62(58)86(61(57)31-44)65-25-43(36-85)26-66(67(65)56-11-6-42(35-84)24-41(56)5)87-63-33-46(50-18-39(3)22-54(29-50)70(78,79)80)9-14-59(63)60-15-10-47(34-64(60)87)51-19-40(4)23-55(30-51)71(81,82)83/h6-34H,1-5H3 |
| InChIKey | WLGITQXWUDGANE-UHFFFAOYSA-N |
| XLogP | 21.58 |
| TPSA | 57.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 87 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1181.14 |
| LogP ≤ 5 | 21.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |