C49H36F3N3 — CID 160652858
9-[2-[2-(3,6-dimethylcarbazol-9-yl)-6-isocyanophenyl]-3-[3-methyl-5-(trifluoromethyl)phenyl]phenyl]-3,6-dimethylcarbazole (PubChem CID 160652858) has the molecular formula C49H36F3N3 and a molecular weight of 723.84 g/mol. Its IUPAC name is 9-[2-[2-(3,6-dimethylcarbazol-9-yl)-6-isocyanophenyl]-3-[3-methyl-5-(trifluoromethyl)phenyl]phenyl]-3,6-dimethylcarbazole.
| Compound Name | 9-[2-[2-(3,6-dimethylcarbazol-9-yl)-6-isocyanophenyl]-3-[3-methyl-5-(trifluoromethyl)phenyl]phenyl]-3,6-dimethylcarbazole |
|---|---|
| PubChem CID | 160652858 |
| Molecular Formula | C49H36F3N3 |
| Molecular Weight | 723.84 g/mol |
| Exact Mass | 723.29 |
| IUPAC Name | 9-[2-[2-(3,6-dimethylcarbazol-9-yl)-6-isocyanophenyl]-3-[3-methyl-5-(trifluoromethyl)phenyl]phenyl]-3,6-dimethylcarbazole |
| SMILES | [C-]#[N+]c1cccc(-n2c3ccc(C)cc3c3cc(C)ccc32)c1-c1c(-c2cc(C)cc(C(F)(F)F)c2)cccc1-n1c2ccc(C)cc2c2cc(C)ccc21 |
| InChI | InChI=1S/C49H36F3N3/c1-28-13-17-41-36(23-28)37-24-29(2)14-18-42(37)54(41)45-11-7-9-35(33-21-32(5)22-34(27-33)49(50,51)52)47(45)48-40(53-6)10-8-12-46(48)55-43-19-15-30(3)25-38(43)39-26-31(4)16-20-44(39)55/h7-27H,1-5H3 |
| InChIKey | HEYAYHNLKWQJAB-UHFFFAOYSA-N |
| XLogP | 14.33 |
| TPSA | 14.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.84 |
| LogP ≤ 5 | 14.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|