C47H32F3N3 — CID 162110190
9-[4-isocyano-2-[2-(2-methylcarbazol-9-yl)-3-[3-methyl-5-(trifluoromethyl)phenyl]phenyl]phenyl]-2-methylcarbazole (PubChem CID 162110190) has the molecular formula C47H32F3N3 and a molecular weight of 695.79 g/mol. Its IUPAC name is 9-[4-isocyano-2-[2-(2-methylcarbazol-9-yl)-3-[3-methyl-5-(trifluoromethyl)phenyl]phenyl]phenyl]-2-methylcarbazole.
| Compound Name | 9-[4-isocyano-2-[2-(2-methylcarbazol-9-yl)-3-[3-methyl-5-(trifluoromethyl)phenyl]phenyl]phenyl]-2-methylcarbazole |
|---|---|
| PubChem CID | 162110190 |
| Molecular Formula | C47H32F3N3 |
| Molecular Weight | 695.79 g/mol |
| Exact Mass | 695.25 |
| IUPAC Name | 9-[4-isocyano-2-[2-(2-methylcarbazol-9-yl)-3-[3-methyl-5-(trifluoromethyl)phenyl]phenyl]phenyl]-2-methylcarbazole |
| SMILES | [C-]#[N+]c1ccc(-n2c3ccccc3c3ccc(C)cc32)c(-c2cccc(-c3cc(C)cc(C(F)(F)F)c3)c2-n2c3ccccc3c3ccc(C)cc32)c1 |
| InChI | InChI=1S/C47H32F3N3/c1-28-16-19-37-35-10-5-7-14-41(35)52(44(37)24-28)43-21-18-33(51-4)27-40(43)39-13-9-12-34(31-22-30(3)23-32(26-31)47(48,49)50)46(39)53-42-15-8-6-11-36(42)38-20-17-29(2)25-45(38)53/h5-27H,1-3H3 |
| InChIKey | DJWKMYBWTOKUHL-UHFFFAOYSA-N |
| XLogP | 13.71 |
| TPSA | 14.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.79 |
| LogP ≤ 5 | 13.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|