C47H29F6N3 — CID 160809909
9-[4-[3,5-bis(trifluoromethyl)phenyl]-2-[4-isocyano-2-(2-methylcarbazol-9-yl)phenyl]phenyl]-2-methylcarbazole (PubChem CID 160809909) has the molecular formula C47H29F6N3 and a molecular weight of 749.76 g/mol. Its IUPAC name is 9-[4-[3,5-bis(trifluoromethyl)phenyl]-2-[4-isocyano-2-(2-methylcarbazol-9-yl)phenyl]phenyl]-2-methylcarbazole.
| Compound Name | 9-[4-[3,5-bis(trifluoromethyl)phenyl]-2-[4-isocyano-2-(2-methylcarbazol-9-yl)phenyl]phenyl]-2-methylcarbazole |
|---|---|
| PubChem CID | 160809909 |
| Molecular Formula | C47H29F6N3 |
| Molecular Weight | 749.76 g/mol |
| Exact Mass | 749.23 |
| IUPAC Name | 9-[4-[3,5-bis(trifluoromethyl)phenyl]-2-[4-isocyano-2-(2-methylcarbazol-9-yl)phenyl]phenyl]-2-methylcarbazole |
| SMILES | [C-]#[N+]c1ccc(-c2cc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)ccc2-n2c3ccccc3c3ccc(C)cc32)c(-n2c3ccccc3c3ccc(C)cc32)c1 |
| InChI | InChI=1S/C47H29F6N3/c1-27-12-16-36-34-8-4-6-10-40(34)55(43(36)20-27)42-19-14-29(30-22-31(46(48,49)50)25-32(23-30)47(51,52)53)24-39(42)38-18-15-33(54-3)26-45(38)56-41-11-7-5-9-35(41)37-17-13-28(2)21-44(37)56/h4-26H,1-2H3 |
| InChIKey | AFIXJJTWAAPETK-UHFFFAOYSA-N |
| XLogP | 14.42 |
| TPSA | 14.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.76 |
| LogP ≤ 5 | 14.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|