C48H32F3N9 — CID 153435087
3-(4,6-dimethyl-1,3,5-triazin-2-yl)-9-[2-[2-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-4-isocyanophenyl]-4-(trifluoromethyl)phenyl]carbazole (PubChem CID 153435087) has the molecular formula C48H32F3N9 and a molecular weight of 791.84 g/mol. Its IUPAC name is 3-(4,6-dimethyl-1,3,5-triazin-2-yl)-9-[2-[2-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-4-isocyanophenyl]-4-(trifluoromethyl)phenyl]carbazole.
| Compound Name | 3-(4,6-dimethyl-1,3,5-triazin-2-yl)-9-[2-[2-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-4-isocyanophenyl]-4-(trifluoromethyl)phenyl]carbazole |
|---|---|
| PubChem CID | 153435087 |
| Molecular Formula | C48H32F3N9 |
| Molecular Weight | 791.84 g/mol |
| Exact Mass | 791.27 |
| IUPAC Name | 3-(4,6-dimethyl-1,3,5-triazin-2-yl)-9-[2-[2-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-4-isocyanophenyl]-4-(trifluoromethyl)phenyl]carbazole |
| SMILES | [C-]#[N+]c1ccc(-c2cc(C(F)(F)F)ccc2-n2c3ccccc3c3cc(-c4nc(C)nc(C)n4)ccc32)c(-n2c3ccccc3c3cc(-c4nc(C)nc(C)n4)ccc32)c1 |
| InChI | InChI=1S/C48H32F3N9/c1-26-53-27(2)56-46(55-26)30-14-19-42-37(22-30)34-10-6-8-12-40(34)59(42)44-21-16-32(48(49,50)51)24-39(44)36-18-17-33(52-5)25-45(36)60-41-13-9-7-11-35(41)38-23-31(15-20-43(38)60)47-57-28(3)54-29(4)58-47/h6-25H,1-4H3 |
| InChIKey | JPRITCXJHTYFAA-UHFFFAOYSA-N |
| XLogP | 12.06 |
| TPSA | 91.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.84 |
| LogP ≤ 5 | 12.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|