C48H32F3N9 — CID 139526155
3-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-2-[2-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-5-(trifluoromethyl)phenyl]benzonitrile (PubChem CID 139526155) has the molecular formula C48H32F3N9 and a molecular weight of 791.84 g/mol. Its IUPAC name is 3-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-2-[2-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-5-(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 3-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-2-[2-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-5-(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 139526155 |
| Molecular Formula | C48H32F3N9 |
| Molecular Weight | 791.84 g/mol |
| Exact Mass | 791.27 |
| IUPAC Name | 3-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-2-[2-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-5-(trifluoromethyl)phenyl]benzonitrile |
| SMILES | Cc1nc(C)nc(-c2ccc3c(c2)c2ccccc2n3-c2ccc(C(F)(F)F)cc2-c2c(C#N)cccc2-n2c3ccccc3c3cc(-c4nc(C)nc(C)n4)ccc32)n1 |
| InChI | InChI=1S/C48H32F3N9/c1-26-53-27(2)56-46(55-26)30-16-19-41-36(22-30)34-11-5-7-13-39(34)59(41)43-21-18-33(48(49,50)51)24-38(43)45-32(25-52)10-9-15-44(45)60-40-14-8-6-12-35(40)37-23-31(17-20-42(37)60)47-57-28(3)54-29(4)58-47/h5-24H,1-4H3 |
| InChIKey | IPXSSTVHLYOOOL-UHFFFAOYSA-N |
| XLogP | 11.38 |
| TPSA | 110.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.84 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |