C55H38N10 — CID 159212871
3-(4,6-dimethyl-1,3,5-triazin-2-yl)-9-[2-[5-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-2-(4-isocyano-2-methylphenyl)phenyl]-4-isocyanophenyl]carbazole (PubChem CID 159212871) has the molecular formula C55H38N10 and a molecular weight of 838.98 g/mol. Its IUPAC name is 3-(4,6-dimethyl-1,3,5-triazin-2-yl)-9-[2-[5-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-2-(4-isocyano-2-methylphenyl)phenyl]-4-isocyanophenyl]carbazole.
| Compound Name | 3-(4,6-dimethyl-1,3,5-triazin-2-yl)-9-[2-[5-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-2-(4-isocyano-2-methylphenyl)phenyl]-4-isocyanophenyl]carbazole |
|---|---|
| PubChem CID | 159212871 |
| Molecular Formula | C55H38N10 |
| Molecular Weight | 838.98 g/mol |
| Exact Mass | 838.33 |
| IUPAC Name | 3-(4,6-dimethyl-1,3,5-triazin-2-yl)-9-[2-[5-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-2-(4-isocyano-2-methylphenyl)phenyl]-4-isocyanophenyl]carbazole |
| SMILES | [C-]#[N+]c1ccc(-c2ccc(-n3c4ccccc4c4cc(-c5nc(C)nc(C)n5)ccc43)cc2-c2cc([N+]#[C-])ccc2-n2c3ccccc3c3cc(-c4nc(C)nc(C)n4)ccc32)c(C)c1 |
| InChI | InChI=1S/C55H38N10/c1-31-26-38(56-6)18-21-41(31)42-22-20-40(64-49-14-10-8-12-43(49)46-27-36(16-23-51(46)64)54-60-32(2)58-33(3)61-54)30-45(42)48-29-39(57-7)19-25-53(48)65-50-15-11-9-13-44(50)47-28-37(17-24-52(47)65)55-62-34(4)59-35(5)63-55/h8-30H,1-5H3 |
| InChIKey | KSJIRQOZBGTDFW-UHFFFAOYSA-N |
| XLogP | 13.56 |
| TPSA | 95.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.98 |
| LogP ≤ 5 | 13.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|