C49H34N10 — CID 159804651
3-[4,5-bis[3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-2-methylphenyl]-5-isocyanobenzonitrile (PubChem CID 159804651) has the molecular formula C49H34N10 and a molecular weight of 762.88 g/mol. Its IUPAC name is 3-[4,5-bis[3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-2-methylphenyl]-5-isocyanobenzonitrile.
| Compound Name | 3-[4,5-bis[3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-2-methylphenyl]-5-isocyanobenzonitrile |
|---|---|
| PubChem CID | 159804651 |
| Molecular Formula | C49H34N10 |
| Molecular Weight | 762.88 g/mol |
| Exact Mass | 762.30 |
| IUPAC Name | 3-[4,5-bis[3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-2-methylphenyl]-5-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)cc(-c2cc(-n3c4ccccc4c4cc(-c5nc(C)nc(C)n5)ccc43)c(-n3c4ccccc4c4cc(-c5nc(C)nc(C)n5)ccc43)cc2C)c1 |
| InChI | InChI=1S/C49H34N10/c1-27-19-46(58-42-13-9-7-11-37(42)40-23-33(15-17-44(40)58)48-54-28(2)52-29(3)55-48)47(25-39(27)35-20-32(26-50)21-36(22-35)51-6)59-43-14-10-8-12-38(43)41-24-34(16-18-45(41)59)49-56-30(4)53-31(5)57-49/h7-25H,1-5H3 |
| InChIKey | WWIGKWMCHHOHOR-UHFFFAOYSA-N |
| XLogP | 11.22 |
| TPSA | 115.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.88 |
| LogP ≤ 5 | 11.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|