C61H44N4 — CID 159884124
4-[3-[3-(2,4-dimethylphenyl)carbazol-9-yl]-2-[2-[3-(2,4-dimethylphenyl)carbazol-9-yl]-6-isocyanophenyl]phenyl]-3-methylbenzonitrile (PubChem CID 159884124) has the molecular formula C61H44N4 and a molecular weight of 833.05 g/mol. Its IUPAC name is 4-[3-[3-(2,4-dimethylphenyl)carbazol-9-yl]-2-[2-[3-(2,4-dimethylphenyl)carbazol-9-yl]-6-isocyanophenyl]phenyl]-3-methylbenzonitrile.
| Compound Name | 4-[3-[3-(2,4-dimethylphenyl)carbazol-9-yl]-2-[2-[3-(2,4-dimethylphenyl)carbazol-9-yl]-6-isocyanophenyl]phenyl]-3-methylbenzonitrile |
|---|---|
| PubChem CID | 159884124 |
| Molecular Formula | C61H44N4 |
| Molecular Weight | 833.05 g/mol |
| Exact Mass | 832.36 |
| IUPAC Name | 4-[3-[3-(2,4-dimethylphenyl)carbazol-9-yl]-2-[2-[3-(2,4-dimethylphenyl)carbazol-9-yl]-6-isocyanophenyl]phenyl]-3-methylbenzonitrile |
| SMILES | [C-]#[N+]c1cccc(-n2c3ccccc3c3cc(-c4ccc(C)cc4C)ccc32)c1-c1c(-c2ccc(C#N)cc2C)cccc1-n1c2ccccc2c2cc(-c3ccc(C)cc3C)ccc21 |
| InChI | InChI=1S/C61H44N4/c1-37-21-26-45(39(3)31-37)43-24-29-56-51(34-43)48-13-7-9-17-54(48)64(56)58-19-11-15-50(47-28-23-42(36-62)33-41(47)5)60(58)61-53(63-6)16-12-20-59(61)65-55-18-10-8-14-49(55)52-35-44(25-30-57(52)65)46-27-22-38(2)32-40(46)4/h7-35H,1-5H3 |
| InChIKey | XKJAQRGUKFQCMH-UHFFFAOYSA-N |
| XLogP | 16.51 |
| TPSA | 38.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.05 |
| LogP ≤ 5 | 16.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|