C73H52N4 — CID 158238706
4-[4-[3,6-bis(4-methylphenyl)carbazol-9-yl]-3-[2-[3,6-bis(4-methylphenyl)carbazol-9-yl]-6-isocyanophenyl]phenyl]-3-methylbenzonitrile (PubChem CID 158238706) has the molecular formula C73H52N4 and a molecular weight of 985.25 g/mol. Its IUPAC name is 4-[4-[3,6-bis(4-methylphenyl)carbazol-9-yl]-3-[2-[3,6-bis(4-methylphenyl)carbazol-9-yl]-6-isocyanophenyl]phenyl]-3-methylbenzonitrile.
| Compound Name | 4-[4-[3,6-bis(4-methylphenyl)carbazol-9-yl]-3-[2-[3,6-bis(4-methylphenyl)carbazol-9-yl]-6-isocyanophenyl]phenyl]-3-methylbenzonitrile |
|---|---|
| PubChem CID | 158238706 |
| Molecular Formula | C73H52N4 |
| Molecular Weight | 985.25 g/mol |
| Exact Mass | 984.42 |
| IUPAC Name | 4-[4-[3,6-bis(4-methylphenyl)carbazol-9-yl]-3-[2-[3,6-bis(4-methylphenyl)carbazol-9-yl]-6-isocyanophenyl]phenyl]-3-methylbenzonitrile |
| SMILES | [C-]#[N+]c1cccc(-n2c3ccc(-c4ccc(C)cc4)cc3c3cc(-c4ccc(C)cc4)ccc32)c1-c1cc(-c2ccc(C#N)cc2C)ccc1-n1c2ccc(-c3ccc(C)cc3)cc2c2cc(-c3ccc(C)cc3)ccc21 |
| InChI | InChI=1S/C73H52N4/c1-45-10-19-51(20-11-45)55-27-33-67-61(39-55)62-40-56(52-21-12-46(2)13-22-52)28-34-68(62)76(67)71-37-31-59(60-32-18-50(44-74)38-49(60)5)43-65(71)73-66(75-6)8-7-9-72(73)77-69-35-29-57(53-23-14-47(3)15-24-53)41-63(69)64-42-58(30-36-70(64)77)54-25-16-48(4)17-26-54/h7-43H,1-5H3 |
| InChIKey | FCOVQLQMTPNMGE-UHFFFAOYSA-N |
| XLogP | 19.85 |
| TPSA | 38.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 985.25 |
| LogP ≤ 5 | 19.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|