C77H60N4 — CID 161184541
4-[4-[3,6-bis(2,4-dimethylphenyl)carbazol-9-yl]-3-[2-[3,6-bis(2,4-dimethylphenyl)carbazol-9-yl]-6-isocyanophenyl]phenyl]-3-methylbenzonitrile (PubChem CID 161184541) has the molecular formula C77H60N4 and a molecular weight of 1041.35 g/mol. Its IUPAC name is 4-[4-[3,6-bis(2,4-dimethylphenyl)carbazol-9-yl]-3-[2-[3,6-bis(2,4-dimethylphenyl)carbazol-9-yl]-6-isocyanophenyl]phenyl]-3-methylbenzonitrile.
| Compound Name | 4-[4-[3,6-bis(2,4-dimethylphenyl)carbazol-9-yl]-3-[2-[3,6-bis(2,4-dimethylphenyl)carbazol-9-yl]-6-isocyanophenyl]phenyl]-3-methylbenzonitrile |
|---|---|
| PubChem CID | 161184541 |
| Molecular Formula | C77H60N4 |
| Molecular Weight | 1041.35 g/mol |
| Exact Mass | 1040.48 |
| IUPAC Name | 4-[4-[3,6-bis(2,4-dimethylphenyl)carbazol-9-yl]-3-[2-[3,6-bis(2,4-dimethylphenyl)carbazol-9-yl]-6-isocyanophenyl]phenyl]-3-methylbenzonitrile |
| SMILES | [C-]#[N+]c1cccc(-n2c3ccc(-c4ccc(C)cc4C)cc3c3cc(-c4ccc(C)cc4C)ccc32)c1-c1cc(-c2ccc(C#N)cc2C)ccc1-n1c2ccc(-c3ccc(C)cc3C)cc2c2cc(-c3ccc(C)cc3C)ccc21 |
| InChI | InChI=1S/C77H60N4/c1-45-14-24-60(49(5)34-45)55-19-29-71-65(39-55)66-40-56(61-25-15-46(2)35-50(61)6)20-30-72(66)80(71)75-33-23-59(64-28-18-54(44-78)38-53(64)9)43-69(75)77-70(79-10)12-11-13-76(77)81-73-31-21-57(62-26-16-47(3)36-51(62)7)41-67(73)68-42-58(22-32-74(68)81)63-27-17-48(4)37-52(63)8/h11-43H,1-9H3 |
| InChIKey | QMUOACPNDUDCCC-UHFFFAOYSA-N |
| XLogP | 21.08 |
| TPSA | 38.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 81 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1041.35 |
| LogP ≤ 5 | 21.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|