C73H52N4 — CID 159302498
9-[2-[2-[3,6-bis(2-methylphenyl)carbazol-9-yl]-6-(4-isocyano-2-methylphenyl)phenyl]-3-isocyanophenyl]-3,6-bis(2-methylphenyl)carbazole (PubChem CID 159302498) has the molecular formula C73H52N4 and a molecular weight of 985.25 g/mol. Its IUPAC name is 9-[2-[2-[3,6-bis(2-methylphenyl)carbazol-9-yl]-6-(4-isocyano-2-methylphenyl)phenyl]-3-isocyanophenyl]-3,6-bis(2-methylphenyl)carbazole.
| Compound Name | 9-[2-[2-[3,6-bis(2-methylphenyl)carbazol-9-yl]-6-(4-isocyano-2-methylphenyl)phenyl]-3-isocyanophenyl]-3,6-bis(2-methylphenyl)carbazole |
|---|---|
| PubChem CID | 159302498 |
| Molecular Formula | C73H52N4 |
| Molecular Weight | 985.25 g/mol |
| Exact Mass | 984.42 |
| IUPAC Name | 9-[2-[2-[3,6-bis(2-methylphenyl)carbazol-9-yl]-6-(4-isocyano-2-methylphenyl)phenyl]-3-isocyanophenyl]-3,6-bis(2-methylphenyl)carbazole |
| SMILES | [C-]#[N+]c1ccc(-c2cccc(-n3c4ccc(-c5ccccc5C)cc4c4cc(-c5ccccc5C)ccc43)c2-c2c([N+]#[C-])cccc2-n2c3ccc(-c4ccccc4C)cc3c3cc(-c4ccccc4C)ccc32)c(C)c1 |
| InChI | InChI=1S/C73H52N4/c1-45-18-8-12-22-55(45)50-30-36-66-61(41-50)62-42-51(56-23-13-9-19-46(56)2)31-37-67(62)76(66)70-28-16-26-60(59-35-34-54(74-6)40-49(59)5)72(70)73-65(75-7)27-17-29-71(73)77-68-38-32-52(57-24-14-10-20-47(57)3)43-63(68)64-44-53(33-39-69(64)77)58-25-15-11-21-48(58)4/h8-44H,1-5H3 |
| InChIKey | YSVQKOMOTKWQFT-UHFFFAOYSA-N |
| XLogP | 20.53 |
| TPSA | 18.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 985.25 |
| LogP ≤ 5 | 20.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|