C26H15FN2 — CID 140701586
5-(2,6-diphenylphenyl)-2-fluoro-3-isocyanobenzonitrile (PubChem CID 140701586) has the molecular formula C26H15FN2 and a molecular weight of 374.42 g/mol. Its IUPAC name is 5-(2,6-diphenylphenyl)-2-fluoro-3-isocyanobenzonitrile.
| Compound Name | 5-(2,6-diphenylphenyl)-2-fluoro-3-isocyanobenzonitrile |
|---|---|
| PubChem CID | 140701586 |
| Molecular Formula | C26H15FN2 |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 5-(2,6-diphenylphenyl)-2-fluoro-3-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cc(-c2c(-c3ccccc3)cccc2-c2ccccc2)cc(C#N)c1F |
| InChI | InChI=1S/C26H15FN2/c1-29-24-16-20(15-21(17-28)26(24)27)25-22(18-9-4-2-5-10-18)13-8-14-23(25)19-11-6-3-7-12-19/h2-16H |
| InChIKey | FSMCFYIRCBHADD-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|