C22H11FN2 — CID 140701413
2-fluoro-3-isocyano-5-phenanthren-9-ylbenzonitrile (PubChem CID 140701413) has the molecular formula C22H11FN2 and a molecular weight of 322.34 g/mol. Its IUPAC name is 2-fluoro-3-isocyano-5-phenanthren-9-ylbenzonitrile.
| Compound Name | 2-fluoro-3-isocyano-5-phenanthren-9-ylbenzonitrile |
|---|---|
| PubChem CID | 140701413 |
| Molecular Formula | C22H11FN2 |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 2-fluoro-3-isocyano-5-phenanthren-9-ylbenzonitrile |
| SMILES | [C-]#[N+]c1cc(-c2cc3ccccc3c3ccccc23)cc(C#N)c1F |
| InChI | InChI=1S/C22H11FN2/c1-25-21-12-15(10-16(13-24)22(21)23)20-11-14-6-2-3-7-17(14)18-8-4-5-9-19(18)20/h2-12H |
| InChIKey | KPWYIJYPIHZSIN-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|