C32H20FN3 — CID 140701583
2-fluoro-3-isocyano-5-(3-phenyl-N-(3-phenylphenyl)anilino)benzonitrile (PubChem CID 140701583) has the molecular formula C32H20FN3 and a molecular weight of 465.53 g/mol. Its IUPAC name is 2-fluoro-3-isocyano-5-(3-phenyl-N-(3-phenylphenyl)anilino)benzonitrile.
| Compound Name | 2-fluoro-3-isocyano-5-(3-phenyl-N-(3-phenylphenyl)anilino)benzonitrile |
|---|---|
| PubChem CID | 140701583 |
| Molecular Formula | C32H20FN3 |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 2-fluoro-3-isocyano-5-(3-phenyl-N-(3-phenylphenyl)anilino)benzonitrile |
| SMILES | [C-]#[N+]c1cc(N(c2cccc(-c3ccccc3)c2)c2cccc(-c3ccccc3)c2)cc(C#N)c1F |
| InChI | InChI=1S/C32H20FN3/c1-35-31-21-30(20-27(22-34)32(31)33)36(28-16-8-14-25(18-28)23-10-4-2-5-11-23)29-17-9-15-26(19-29)24-12-6-3-7-13-24/h2-21H |
| InChIKey | RVQIZZHAKRGHDS-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 31.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|