C26H9F3N6 — CID 140701493
5-[1,1-bis(3-cyano-4-fluoro-5-isocyanophenyl)ethyl]-2-fluorobenzene-1,3-dicarbonitrile (PubChem CID 140701493) has the molecular formula C26H9F3N6 and a molecular weight of 462.39 g/mol. Its IUPAC name is 5-[1,1-bis(3-cyano-4-fluoro-5-isocyanophenyl)ethyl]-2-fluorobenzene-1,3-dicarbonitrile.
| Compound Name | 5-[1,1-bis(3-cyano-4-fluoro-5-isocyanophenyl)ethyl]-2-fluorobenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 140701493 |
| Molecular Formula | C26H9F3N6 |
| Molecular Weight | 462.39 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | 5-[1,1-bis(3-cyano-4-fluoro-5-isocyanophenyl)ethyl]-2-fluorobenzene-1,3-dicarbonitrile |
| SMILES | [C-]#[N+]c1cc(C(C)(c2cc(C#N)c(F)c(C#N)c2)c2cc(C#N)c(F)c([N+]#[C-])c2)cc(C#N)c1F |
| InChI | InChI=1S/C26H9F3N6/c1-26(18-4-14(10-30)23(27)15(5-18)11-31,19-6-16(12-32)24(28)21(8-19)34-2)20-7-17(13-33)25(29)22(9-20)35-3/h4-9H,1H3 |
| InChIKey | BNYQJZMOOAHWDB-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 103.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.39 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|