C53H34N6O3 — CID 153426957
4-[4-[1-[4-(3-cyano-4-isocyanophenoxy)phenyl]-1-[4-[2-[4-(3-cyano-4-isocyanophenoxy)phenyl]propan-2-yl]phenyl]ethyl]phenoxy]-2-isocyanobenzonitrile (PubChem CID 153426957) has the molecular formula C53H34N6O3 and a molecular weight of 802.89 g/mol. Its IUPAC name is 4-[4-[1-[4-(3-cyano-4-isocyanophenoxy)phenyl]-1-[4-[2-[4-(3-cyano-4-isocyanophenoxy)phenyl]propan-2-yl]phenyl]ethyl]phenoxy]-2-isocyanobenzonitrile.
| Compound Name | 4-[4-[1-[4-(3-cyano-4-isocyanophenoxy)phenyl]-1-[4-[2-[4-(3-cyano-4-isocyanophenoxy)phenyl]propan-2-yl]phenyl]ethyl]phenoxy]-2-isocyanobenzonitrile |
|---|---|
| PubChem CID | 153426957 |
| Molecular Formula | C53H34N6O3 |
| Molecular Weight | 802.89 g/mol |
| Exact Mass | 802.27 |
| IUPAC Name | 4-[4-[1-[4-(3-cyano-4-isocyanophenoxy)phenyl]-1-[4-[2-[4-(3-cyano-4-isocyanophenoxy)phenyl]propan-2-yl]phenyl]ethyl]phenoxy]-2-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1ccc(Oc2ccc(C(C)(C)c3ccc(C(C)(c4ccc(Oc5ccc([N+]#[C-])c(C#N)c5)cc4)c4ccc(Oc5ccc(C#N)c([N+]#[C-])c5)cc4)cc3)cc2)cc1C#N |
| InChI | InChI=1S/C53H34N6O3/c1-52(2,39-12-19-43(20-13-39)60-46-25-27-49(57-4)36(29-46)33-55)38-8-10-40(11-9-38)53(3,41-14-21-44(22-15-41)61-47-26-28-50(58-5)37(30-47)34-56)42-16-23-45(24-17-42)62-48-18-7-35(32-54)51(31-48)59-6/h7-31H,1-3H3 |
| InChIKey | RULRIRIJSSXCQR-UHFFFAOYSA-N |
| XLogP | 14.01 |
| TPSA | 112.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.89 |
| LogP ≤ 5 | 14.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|