C52H49N3O4 — CID 161103659
5-[4-[2-[4-[6-[4-[2-[4-(3,4-diisocyanophenoxy)phenyl]propan-2-yl]phenoxy]hexoxy]phenyl]propan-2-yl]phenoxy]-2-methylbenzonitrile (PubChem CID 161103659) has the molecular formula C52H49N3O4 and a molecular weight of 779.98 g/mol. Its IUPAC name is 5-[4-[2-[4-[6-[4-[2-[4-(3,4-diisocyanophenoxy)phenyl]propan-2-yl]phenoxy]hexoxy]phenyl]propan-2-yl]phenoxy]-2-methylbenzonitrile.
| Compound Name | 5-[4-[2-[4-[6-[4-[2-[4-(3,4-diisocyanophenoxy)phenyl]propan-2-yl]phenoxy]hexoxy]phenyl]propan-2-yl]phenoxy]-2-methylbenzonitrile |
|---|---|
| PubChem CID | 161103659 |
| Molecular Formula | C52H49N3O4 |
| Molecular Weight | 779.98 g/mol |
| Exact Mass | 779.37 |
| IUPAC Name | 5-[4-[2-[4-[6-[4-[2-[4-(3,4-diisocyanophenoxy)phenyl]propan-2-yl]phenoxy]hexoxy]phenyl]propan-2-yl]phenoxy]-2-methylbenzonitrile |
| SMILES | [C-]#[N+]c1ccc(Oc2ccc(C(C)(C)c3ccc(OCCCCCCOc4ccc(C(C)(C)c5ccc(Oc6ccc(C)c(C#N)c6)cc5)cc4)cc3)cc2)cc1[N+]#[C-] |
| InChI | InChI=1S/C52H49N3O4/c1-37-12-21-47(34-38(37)36-53)58-45-26-17-41(18-27-45)51(2,3)39-13-22-43(23-14-39)56-32-10-8-9-11-33-57-44-24-15-40(16-25-44)52(4,5)42-19-28-46(29-20-42)59-48-30-31-49(54-6)50(35-48)55-7/h12-31,34-35H,8-11,32-33H2,1-5H3 |
| InChIKey | UITNTXQYCMXOPT-UHFFFAOYSA-N |
| XLogP | 14.22 |
| TPSA | 69.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.98 |
| LogP ≤ 5 | 14.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|