C15H10N2O — CID 165007641
2-isocyano-5-(4-methylphenoxy)benzonitrile (PubChem CID 165007641) has the molecular formula C15H10N2O and a molecular weight of 234.26 g/mol. Its IUPAC name is 2-isocyano-5-(4-methylphenoxy)benzonitrile.
| Compound Name | 2-isocyano-5-(4-methylphenoxy)benzonitrile |
|---|---|
| PubChem CID | 165007641 |
| Molecular Formula | C15H10N2O |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 2-isocyano-5-(4-methylphenoxy)benzonitrile |
| SMILES | [C-]#[N+]c1ccc(Oc2ccc(C)cc2)cc1C#N |
| InChI | InChI=1S/C15H10N2O/c1-11-3-5-13(6-4-11)18-14-7-8-15(17-2)12(9-14)10-16/h3-9H,1H3 |
| InChIKey | CQSZUYAYOZKERC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|