C34H19N4O3P — CID 20750525
4-[4-[[4-(3,4-diisocyanophenoxy)phenyl]-phenylphosphoryl]phenoxy]benzene-1,2-dicarbonitrile (PubChem CID 20750525) has the molecular formula C34H19N4O3P and a molecular weight of 562.53 g/mol. Its IUPAC name is 4-[4-[[4-(3,4-diisocyanophenoxy)phenyl]-phenylphosphoryl]phenoxy]benzene-1,2-dicarbonitrile.
| Compound Name | 4-[4-[[4-(3,4-diisocyanophenoxy)phenyl]-phenylphosphoryl]phenoxy]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 20750525 |
| Molecular Formula | C34H19N4O3P |
| Molecular Weight | 562.53 g/mol |
| Exact Mass | 562.12 |
| IUPAC Name | 4-[4-[[4-(3,4-diisocyanophenoxy)phenyl]-phenylphosphoryl]phenoxy]benzene-1,2-dicarbonitrile |
| SMILES | [C-]#[N+]c1ccc(Oc2ccc(P(=O)(c3ccccc3)c3ccc(Oc4ccc(C#N)c(C#N)c4)cc3)cc2)cc1[N+]#[C-] |
| InChI | InChI=1S/C34H19N4O3P/c1-37-33-19-14-29(21-34(33)38-2)41-27-12-17-32(18-13-27)42(39,30-6-4-3-5-7-30)31-15-10-26(11-16-31)40-28-9-8-24(22-35)25(20-28)23-36/h3-21H |
| InChIKey | DRQAZLIPMQBBIR-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.53 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|